C20H12BrN3O3S — CID 17280923
(E)-3-[5-[(4-bromophenoxy)methyl]furan-2-yl]-2-cyano-N-(3-cyanothiophen-2-yl)prop-2-enamide (PubChem CID 17280923) has the molecular formula C20H12BrN3O3S and a molecular weight of 454.31 g/mol. Its IUPAC name is (E)-3-[5-[(4-bromophenoxy)methyl]furan-2-yl]-2-cyano-N-(3-cyanothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-[(4-bromophenoxy)methyl]furan-2-yl]-2-cyano-N-(3-cyanothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17280923 |
| Molecular Formula | C20H12BrN3O3S |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 452.98 |
| IUPAC Name | (E)-3-[5-[(4-bromophenoxy)methyl]furan-2-yl]-2-cyano-N-(3-cyanothiophen-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(COc2ccc(Br)cc2)o1)C(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C20H12BrN3O3S/c21-15-1-3-16(4-2-15)26-12-18-6-5-17(27-18)9-14(11-23)19(25)24-20-13(10-22)7-8-28-20/h1-9H,12H2,(H,24,25)/b14-9+ |
| InChIKey | LFQTXAJBCQQZIB-NTEUORMPSA-N |
| XLogP | 5.10 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|