C27H23N5O6S — CID 17380784
(E)-2-cyano-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 17380784) has the molecular formula C27H23N5O6S and a molecular weight of 545.58 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17380784 |
| Molecular Formula | C27H23N5O6S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | (E)-2-cyano-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(OCc2ccc(/C=C(\C#N)C(=O)Nc3ccc(S(=O)(=O)Nc4nccc(C)n4)cc3)o2)cc1 |
| InChI | InChI=1S/C27H23N5O6S/c1-18-13-14-29-27(30-18)32-39(34,35)25-11-3-20(4-12-25)31-26(33)19(16-28)15-23-9-10-24(38-23)17-37-22-7-5-21(36-2)6-8-22/h3-15H,17H2,1-2H3,(H,31,33)(H,29,30,32)/b19-15+ |
| InChIKey | JXZQEXMFHYMWPM-XDJHFCHBSA-N |
| XLogP | 4.31 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|