C24H20N4O7S — CID 19448991
methyl 4-[[5-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate (PubChem CID 19448991) has the molecular formula C24H20N4O7S and a molecular weight of 508.51 g/mol. Its IUPAC name is methyl 4-[[5-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[5-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 19448991 |
| Molecular Formula | C24H20N4O7S |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | methyl 4-[[5-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamoyl]furan-2-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCc2ccc(C(=O)Nc3ccc(S(=O)(=O)Nc4ncccn4)cc3)o2)cc1 |
| InChI | InChI=1S/C24H20N4O7S/c1-33-23(30)16-3-7-18(8-4-16)34-15-19-9-12-21(35-19)22(29)27-17-5-10-20(11-6-17)36(31,32)28-24-25-13-2-14-26-24/h2-14H,15H2,1H3,(H,27,29)(H,25,26,28) |
| InChIKey | GIMQZEBJDPSLFP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |