C26H20N4O5S — CID 19412861
5-(naphthalen-1-yloxymethyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide (PubChem CID 19412861) has the molecular formula C26H20N4O5S and a molecular weight of 500.54 g/mol. Its IUPAC name is 5-(naphthalen-1-yloxymethyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(naphthalen-1-yloxymethyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19412861 |
| Molecular Formula | C26H20N4O5S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 5-(naphthalen-1-yloxymethyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1ccc(COc2cccc3ccccc23)o1 |
| InChI | InChI=1S/C26H20N4O5S/c31-25(29-19-9-12-21(13-10-19)36(32,33)30-26-27-15-4-16-28-26)24-14-11-20(35-24)17-34-23-8-3-6-18-5-1-2-7-22(18)23/h1-16H,17H2,(H,29,31)(H,27,28,30) |
| InChIKey | HPBURQPGUCYORN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |