C21H16N4O7S2 — CID 19446306
5-[(2-nitrophenoxy)methyl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-carboxamide (PubChem CID 19446306) has the molecular formula C21H16N4O7S2 and a molecular weight of 500.51 g/mol. Its IUPAC name is 5-[(2-nitrophenoxy)methyl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-[(2-nitrophenoxy)methyl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446306 |
| Molecular Formula | C21H16N4O7S2 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 5-[(2-nitrophenoxy)methyl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1ccc(COc2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C21H16N4O7S2/c26-20(19-10-7-15(32-19)13-31-18-4-2-1-3-17(18)25(27)28)23-14-5-8-16(9-6-14)34(29,30)24-21-22-11-12-33-21/h1-12H,13H2,(H,22,24)(H,23,26) |
| InChIKey | WZPCUHIIJWAWQQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 153.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|