C24H19N3O3 — CID 19412863
N-(1-methylbenzimidazol-2-yl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide (PubChem CID 19412863) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-(1-methylbenzimidazol-2-yl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-(1-methylbenzimidazol-2-yl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19412863 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-(1-methylbenzimidazol-2-yl)-5-(naphthalen-1-yloxymethyl)furan-2-carboxamide |
| SMILES | Cn1c(NC(=O)c2ccc(COc3cccc4ccccc34)o2)nc2ccccc21 |
| InChI | InChI=1S/C24H19N3O3/c1-27-20-11-5-4-10-19(20)25-24(27)26-23(28)22-14-13-17(30-22)15-29-21-12-6-8-16-7-2-3-9-18(16)21/h2-14H,15H2,1H3,(H,25,26,28) |
| InChIKey | MTEBZJCWMXVZMS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |