C16H11O4- — CID 3596350
5-(naphthalen-1-yloxymethyl)furan-2-carboxylate (PubChem CID 3596350) has the molecular formula C16H11O4- and a molecular weight of 267.26 g/mol. Its IUPAC name is 5-(naphthalen-1-yloxymethyl)furan-2-carboxylate.
| Compound Name | 5-(naphthalen-1-yloxymethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 3596350 |
| Molecular Formula | C16H11O4- |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-(naphthalen-1-yloxymethyl)furan-2-carboxylate |
| SMILES | O=C([O-])c1ccc(COc2cccc3ccccc23)o1 |
| InChI | InChI=1S/C16H12O4/c17-16(18)15-9-8-12(20-15)10-19-14-7-3-5-11-4-1-2-6-13(11)14/h1-9H,10H2,(H,17,18)/p-1 |
| InChIKey | DVUUCZPXJSZJNK-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 62.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |