C20H10Cl3N3O3S — CID 17280922
(E)-2-cyano-N-(3-cyanothiophen-2-yl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-enamide (PubChem CID 17280922) has the molecular formula C20H10Cl3N3O3S and a molecular weight of 478.74 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-cyanothiophen-2-yl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-cyanothiophen-2-yl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17280922 |
| Molecular Formula | C20H10Cl3N3O3S |
| Molecular Weight | 478.74 g/mol |
| Exact Mass | 476.95 |
| IUPAC Name | (E)-2-cyano-N-(3-cyanothiophen-2-yl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(COc2c(Cl)cc(Cl)cc2Cl)o1)C(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C20H10Cl3N3O3S/c21-13-6-16(22)18(17(23)7-13)28-10-15-2-1-14(29-15)5-12(9-25)19(27)26-20-11(8-24)3-4-30-20/h1-7H,10H2,(H,26,27)/b12-5+ |
| InChIKey | UXWAUAHJSPGWOA-LFYBBSHMSA-N |
| XLogP | 6.30 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|