C18H13Cl3N2O3 — CID 51064391
(Z)-2-cyano-N-cyclopropyl-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-enamide (PubChem CID 51064391) has the molecular formula C18H13Cl3N2O3 and a molecular weight of 411.67 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopropyl-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopropyl-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 51064391 |
| Molecular Formula | C18H13Cl3N2O3 |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | (Z)-2-cyano-N-cyclopropyl-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(COc2c(Cl)cc(Cl)cc2Cl)o1)C(=O)NC1CC1 |
| InChI | InChI=1S/C18H13Cl3N2O3/c19-11-6-15(20)17(16(21)7-11)25-9-14-4-3-13(26-14)5-10(8-22)18(24)23-12-1-2-12/h3-7,12H,1-2,9H2,(H,23,24)/b10-5- |
| InChIKey | PEXLZJABJQEFKM-YHYXMXQVSA-N |
| XLogP | 5.00 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|