C20H19ClN2O2S — CID 6269775
(E)-3-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-2-cyano-N-cyclohexylprop-2-enamide (PubChem CID 6269775) has the molecular formula C20H19ClN2O2S and a molecular weight of 386.90 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-2-cyano-N-cyclohexylprop-2-enamide.
| Compound Name | (E)-3-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-2-cyano-N-cyclohexylprop-2-enamide |
|---|---|
| PubChem CID | 6269775 |
| Molecular Formula | C20H19ClN2O2S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-2-cyano-N-cyclohexylprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(Sc2ccc(Cl)cc2)o1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H19ClN2O2S/c21-15-6-9-18(10-7-15)26-19-11-8-17(25-19)12-14(13-22)20(24)23-16-4-2-1-3-5-16/h6-12,16H,1-5H2,(H,23,24)/b14-12+ |
| InChIKey | MIVWQRUJQHNIEW-WYMLVPIESA-N |
| XLogP | 5.44 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|