C22H19BrClFN2O2 — CID 126197264
(Z)-3-[3-bromo-5-chloro-4-[(4-fluorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide (PubChem CID 126197264) has the molecular formula C22H19BrClFN2O2 and a molecular weight of 477.76 g/mol. Its IUPAC name is (Z)-3-[3-bromo-5-chloro-4-[(4-fluorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-5-chloro-4-[(4-fluorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 126197264 |
| Molecular Formula | C22H19BrClFN2O2 |
| Molecular Weight | 477.76 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | (Z)-3-[3-bromo-5-chloro-4-[(4-fluorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Cl)c(OCc2ccc(F)cc2)c(Br)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H19BrClFN2O2/c23-19-10-15(9-16(12-26)22(28)27-18-3-1-2-4-18)11-20(24)21(19)29-13-14-5-7-17(25)8-6-14/h5-11,18H,1-4,13H2,(H,27,28)/b16-9- |
| InChIKey | YYBIPGUVPJHYFR-SXGWCWSVSA-N |
| XLogP | 5.79 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.76 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|