C24H23ClFN3O4 — CID 126197986
(Z)-3-[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide (PubChem CID 126197986) has the molecular formula C24H23ClFN3O4 and a molecular weight of 471.92 g/mol. Its IUPAC name is (Z)-3-[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 126197986 |
| Molecular Formula | C24H23ClFN3O4 |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | (Z)-3-[3-chloro-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)NC2CCCC2)cc(Cl)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H23ClFN3O4/c1-32-21-12-15(10-16(13-27)24(31)29-18-4-2-3-5-18)11-20(25)23(21)33-14-22(30)28-19-8-6-17(26)7-9-19/h6-12,18H,2-5,14H2,1H3,(H,28,30)(H,29,31)/b16-10- |
| InChIKey | MKMWLLMNLFXSDU-YBEGLDIGSA-N |
| XLogP | 4.47 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|