C24H24FN3O4 — CID 126193865
(Z)-2-cyano-N-cyclopentyl-3-[2-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide (PubChem CID 126193865) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopentyl-3-[2-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopentyl-3-[2-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126193865 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (Z)-2-cyano-N-cyclopentyl-3-[2-[2-(4-fluoroanilino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C(/C#N)C(=O)NC2CCCC2)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H24FN3O4/c1-31-21-8-4-5-16(13-17(14-26)24(30)28-19-6-2-3-7-19)23(21)32-15-22(29)27-20-11-9-18(25)10-12-20/h4-5,8-13,19H,2-3,6-7,15H2,1H3,(H,27,29)(H,28,30)/b17-13- |
| InChIKey | ACABFWYSPYDLJK-LGMDPLHJSA-N |
| XLogP | 3.82 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|