C23H22N4O3S2 — CID 17381593
(E)-3-(4-tert-butylphenyl)-2-cyano-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 17381593) has the molecular formula C23H22N4O3S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-2-cyano-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-2-cyano-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17381593 |
| Molecular Formula | C23H22N4O3S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-2-cyano-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(/C=C(\C#N)C(=O)Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)cc1 |
| InChI | InChI=1S/C23H22N4O3S2/c1-23(2,3)18-6-4-16(5-7-18)14-17(15-24)21(28)26-19-8-10-20(11-9-19)32(29,30)27-22-25-12-13-31-22/h4-14H,1-3H3,(H,25,27)(H,26,28)/b17-14+ |
| InChIKey | PXJCANMGPIOVLG-SAPNQHFASA-N |
| XLogP | 4.79 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|