C23H18N4O5S2 — CID 2196863
N-[(Z)-3-oxo-1-phenyl-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]furan-2-carboxamide (PubChem CID 2196863) has the molecular formula C23H18N4O5S2 and a molecular weight of 494.55 g/mol. Its IUPAC name is N-[(Z)-3-oxo-1-phenyl-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | N-[(Z)-3-oxo-1-phenyl-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2196863 |
| Molecular Formula | C23H18N4O5S2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | N-[(Z)-3-oxo-1-phenyl-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)/C(=C/c1ccccc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C23H18N4O5S2/c28-21(19(15-16-5-2-1-3-6-16)26-22(29)20-7-4-13-32-20)25-17-8-10-18(11-9-17)34(30,31)27-23-24-12-14-33-23/h1-15H,(H,24,27)(H,25,28)(H,26,29)/b19-15- |
| InChIKey | RKDVLIPUSKTLDE-CYVLTUHYSA-N |
| XLogP | 3.95 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|