C23H18N4O4S3 — CID 3120733
N-[3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 3120733) has the molecular formula C23H18N4O4S3 and a molecular weight of 510.62 g/mol. Its IUPAC name is N-[3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3120733 |
| Molecular Formula | C23H18N4O4S3 |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | N-[3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)C(=Cc1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H18N4O4S3/c28-21(16-5-2-1-3-6-16)26-20(15-18-7-4-13-32-18)22(29)25-17-8-10-19(11-9-17)34(30,31)27-23-24-12-14-33-23/h1-15H,(H,24,27)(H,25,29)(H,26,28) |
| InChIKey | RLJDFYHFLJUDSD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|