C22H17N5O4S3 — CID 74381633
N-[3-oxo-3-[4-(pyrimidin-2-ylsulfamoyl)anilino]-1-thiophen-2-ylprop-1-en-2-yl]thiophene-2-carboxamide (PubChem CID 74381633) has the molecular formula C22H17N5O4S3 and a molecular weight of 511.61 g/mol. Its IUPAC name is N-[3-oxo-3-[4-(pyrimidin-2-ylsulfamoyl)anilino]-1-thiophen-2-ylprop-1-en-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[3-oxo-3-[4-(pyrimidin-2-ylsulfamoyl)anilino]-1-thiophen-2-ylprop-1-en-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 74381633 |
| Molecular Formula | C22H17N5O4S3 |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | N-[3-oxo-3-[4-(pyrimidin-2-ylsulfamoyl)anilino]-1-thiophen-2-ylprop-1-en-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)C(=Cc1cccs1)NC(=O)c1cccs1 |
| InChI | InChI=1S/C22H17N5O4S3/c28-20(18(14-16-4-1-12-32-16)26-21(29)19-5-2-13-33-19)25-15-6-8-17(9-7-15)34(30,31)27-22-23-10-3-11-24-22/h1-14H,(H,25,28)(H,26,29)(H,23,24,27) |
| InChIKey | PENRZFCUHJBZHQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|