C29H25N3O3S2 — CID 22189344
N-[(Z)-3-[4-(1-anilino-1-oxopropan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 22189344) has the molecular formula C29H25N3O3S2 and a molecular weight of 527.67 g/mol. Its IUPAC name is N-[(Z)-3-[4-(1-anilino-1-oxopropan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-(1-anilino-1-oxopropan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22189344 |
| Molecular Formula | C29H25N3O3S2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | N-[(Z)-3-[4-(1-anilino-1-oxopropan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C29H25N3O3S2/c1-20(27(33)30-22-11-6-3-7-12-22)37-24-16-14-23(15-17-24)31-29(35)26(19-25-13-8-18-36-25)32-28(34)21-9-4-2-5-10-21/h2-20H,1H3,(H,30,33)(H,31,35)(H,32,34)/b26-19- |
| InChIKey | KBHOPBJXBZJVKD-XHPQRKPJSA-N |
| XLogP | 6.28 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|