C30H25N3O6S2 — CID 22189411
5-[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid (PubChem CID 22189411) has the molecular formula C30H25N3O6S2 and a molecular weight of 587.68 g/mol. Its IUPAC name is 5-[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 22189411 |
| Molecular Formula | C30H25N3O6S2 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | 5-[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)cc1)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C30H25N3O6S2/c1-18(27(35)32-21-11-14-26(34)24(16-21)30(38)39)41-22-12-9-20(10-13-22)31-29(37)25(17-23-8-5-15-40-23)33-28(36)19-6-3-2-4-7-19/h2-18,34H,1H3,(H,31,37)(H,32,35)(H,33,36)(H,38,39)/b25-17- |
| InChIKey | ROHUPQBSSMDCQH-UQQQWYQISA-N |
| XLogP | 5.68 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|