C37H29N3O6S — CID 21383703
5-[[2-[4-[[(Z)-2-benzamido-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 21383703) has the molecular formula C37H29N3O6S and a molecular weight of 643.72 g/mol. Its IUPAC name is 5-[[2-[4-[[(Z)-2-benzamido-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[4-[[(Z)-2-benzamido-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 21383703 |
| Molecular Formula | C37H29N3O6S |
| Molecular Weight | 643.72 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | 5-[[2-[4-[[(Z)-2-benzamido-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc(O)c(C(=O)O)c2)c2ccccc2)cc1)/C(=C/c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H29N3O6S/c41-32-21-18-28(23-30(32)37(45)46)39-36(44)33(25-12-6-2-7-13-25)47-29-19-16-27(17-20-29)38-35(43)31(22-24-10-4-1-5-11-24)40-34(42)26-14-8-3-9-15-26/h1-23,33,41H,(H,38,43)(H,39,44)(H,40,42)(H,45,46)/b31-22- |
| InChIKey | DJUQUJPDUVBEAN-VAMRJTSQSA-N |
| XLogP | 6.97 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.72 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|