C39H33N3O7S — CID 22187241
5-[[2-[4-[[(Z)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 22187241) has the molecular formula C39H33N3O7S and a molecular weight of 687.77 g/mol. Its IUPAC name is 5-[[2-[4-[[(Z)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 22187241 |
| Molecular Formula | C39H33N3O7S |
| Molecular Weight | 687.77 g/mol |
| Exact Mass | 687.20 |
| IUPAC Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | CCOc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SC(C(=O)Nc2ccc(O)c(C(=O)O)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H33N3O7S/c1-2-49-34-16-10-9-15-27(34)23-32(42-36(44)26-13-7-4-8-14-26)37(45)40-28-17-20-30(21-18-28)50-35(25-11-5-3-6-12-25)38(46)41-29-19-22-33(43)31(24-29)39(47)48/h3-24,35,43H,2H2,1H3,(H,40,45)(H,41,46)(H,42,44)(H,47,48)/b32-23- |
| InChIKey | ZVHNHPGFFCSHJS-SJIPCVTESA-N |
| XLogP | 7.37 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.77 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|