C41H31N3O6S — CID 19311638
5-[[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 19311638) has the molecular formula C41H31N3O6S and a molecular weight of 693.78 g/mol. Its IUPAC name is 5-[[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19311638 |
| Molecular Formula | C41H31N3O6S |
| Molecular Weight | 693.78 g/mol |
| Exact Mass | 693.19 |
| IUPAC Name | 5-[[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc(O)c(C(=O)O)c2)c2ccccc2)c1)/C(=C\c1cccc2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C41H31N3O6S/c45-36-22-21-31(25-34(36)41(49)50)43-40(48)37(27-12-3-1-4-13-27)51-32-19-10-18-30(24-32)42-39(47)35(44-38(46)28-14-5-2-6-15-28)23-29-17-9-16-26-11-7-8-20-33(26)29/h1-25,37,45H,(H,42,47)(H,43,48)(H,44,46)(H,49,50)/b35-23+ |
| InChIKey | OGKDJRDINJPANG-QCFMCPCVSA-N |
| XLogP | 8.13 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.78 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|