C30H26N4O4S2 — CID 22189408
4-[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide (PubChem CID 22189408) has the molecular formula C30H26N4O4S2 and a molecular weight of 570.70 g/mol. Its IUPAC name is 4-[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide.
| Compound Name | 4-[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide |
|---|---|
| PubChem CID | 22189408 |
| Molecular Formula | C30H26N4O4S2 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | 4-[2-[4-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)cc1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C30H26N4O4S2/c1-19(28(36)32-22-11-9-20(10-12-22)27(31)35)40-24-15-13-23(14-16-24)33-30(38)26(18-25-8-5-17-39-25)34-29(37)21-6-3-2-4-7-21/h2-19H,1H3,(H2,31,35)(H,32,36)(H,33,38)(H,34,37)/b26-18- |
| InChIKey | PBNVCGVJYGYWQA-ITYLOYPMSA-N |
| XLogP | 5.38 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|