C32H27FN4O4S — CID 22187518
4-[2-[4-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide (PubChem CID 22187518) has the molecular formula C32H27FN4O4S and a molecular weight of 582.66 g/mol. Its IUPAC name is 4-[2-[4-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide.
| Compound Name | 4-[2-[4-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide |
|---|---|
| PubChem CID | 22187518 |
| Molecular Formula | C32H27FN4O4S |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | 4-[2-[4-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccccc2F)NC(=O)c2ccccc2)cc1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C32H27FN4O4S/c1-20(30(39)35-24-13-11-21(12-14-24)29(34)38)42-26-17-15-25(16-18-26)36-32(41)28(19-23-9-5-6-10-27(23)33)37-31(40)22-7-3-2-4-8-22/h2-20H,1H3,(H2,34,38)(H,35,39)(H,36,41)(H,37,40)/b28-19- |
| InChIKey | NWJOLUUQOMFYCV-USHMODERSA-N |
| XLogP | 5.45 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|