C32H26FN3O6S — CID 19310270
5-[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid (PubChem CID 19310270) has the molecular formula C32H26FN3O6S and a molecular weight of 599.64 g/mol. Its IUPAC name is 5-[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19310270 |
| Molecular Formula | C32H26FN3O6S |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | 5-[2-[3-[[(Z)-2-benzamido-3-(2-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C/c2ccccc2F)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C32H26FN3O6S/c1-19(29(38)34-23-14-15-28(37)25(18-23)32(41)42)43-24-12-7-11-22(17-24)35-31(40)27(16-21-10-5-6-13-26(21)33)36-30(39)20-8-3-2-4-9-20/h2-19,37H,1H3,(H,34,38)(H,35,40)(H,36,39)(H,41,42)/b27-16- |
| InChIKey | VHIFKGLSULCEQO-YUMHPJSZSA-N |
| XLogP | 5.76 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|