C33H28ClN3O6S — CID 19309105
5-[2-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid (PubChem CID 19309105) has the molecular formula C33H28ClN3O6S and a molecular weight of 630.12 g/mol. Its IUPAC name is 5-[2-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[2-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 19309105 |
| Molecular Formula | C33H28ClN3O6S |
| Molecular Weight | 630.12 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | 5-[2-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-2-chlorobenzoic acid |
| SMILES | COc1ccccc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(C)C(=O)Nc2ccc(Cl)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C33H28ClN3O6S/c1-20(30(38)35-24-15-16-27(34)26(19-24)33(41)42)44-25-13-8-12-23(18-25)36-32(40)28(17-22-11-6-7-14-29(22)43-2)37-31(39)21-9-4-3-5-10-21/h3-20H,1-2H3,(H,35,38)(H,36,40)(H,37,39)(H,41,42)/b28-17+ |
| InChIKey | YTQJNEYCFNUECW-OGLMXYFKSA-N |
| XLogP | 6.58 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.12 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|