C27H24N4O5S2 — CID 3114487
N-[1-(2-methoxyphenyl)-3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]-4-methylbenzamide (PubChem CID 3114487) has the molecular formula C27H24N4O5S2 and a molecular weight of 548.65 g/mol. Its IUPAC name is N-[1-(2-methoxyphenyl)-3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]-4-methylbenzamide.
| Compound Name | N-[1-(2-methoxyphenyl)-3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3114487 |
| Molecular Formula | C27H24N4O5S2 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | N-[1-(2-methoxyphenyl)-3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]-4-methylbenzamide |
| SMILES | COc1ccccc1C=C(NC(=O)c1ccc(C)cc1)C(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C27H24N4O5S2/c1-18-7-9-19(10-8-18)25(32)30-23(17-20-5-3-4-6-24(20)36-2)26(33)29-21-11-13-22(14-12-21)38(34,35)31-27-28-15-16-37-27/h3-17H,1-2H3,(H,28,31)(H,29,33)(H,30,32) |
| InChIKey | HETQMQVRVCGPKM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|