C23H17BrN4O5S2 — CID 2850748
N-[1-(4-bromophenyl)-3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]furan-2-carboxamide (PubChem CID 2850748) has the molecular formula C23H17BrN4O5S2 and a molecular weight of 573.45 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-(4-bromophenyl)-3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2850748 |
| Molecular Formula | C23H17BrN4O5S2 |
| Molecular Weight | 573.45 g/mol |
| Exact Mass | 571.98 |
| IUPAC Name | N-[1-(4-bromophenyl)-3-oxo-3-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]prop-1-en-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)C(=Cc1ccc(Br)cc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C23H17BrN4O5S2/c24-16-5-3-15(4-6-16)14-19(27-22(30)20-2-1-12-33-20)21(29)26-17-7-9-18(10-8-17)35(31,32)28-23-25-11-13-34-23/h1-14H,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | ULGQVFISVKTONR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|