C20H15N3O6S4 — CID 23474952
2-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 23474952) has the molecular formula C20H15N3O6S4 and a molecular weight of 521.62 g/mol. Its IUPAC name is 2-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 2-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 23474952 |
| Molecular Formula | C20H15N3O6S4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 520.98 |
| IUPAC Name | 2-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1C(=O)/C(=C/c2ccc(-c3ccc(S(=O)(=O)Nc4nccs4)cc3)o2)SC1=S |
| InChI | InChI=1S/C20H15N3O6S4/c1-11(18(25)26)23-17(24)16(32-20(23)30)10-13-4-7-15(29-13)12-2-5-14(6-3-12)33(27,28)22-19-21-8-9-31-19/h2-11H,1H3,(H,21,22)(H,25,26)/b16-10- |
| InChIKey | CZKFOKSFUWDEFH-YBEGLDIGSA-N |
| XLogP | 3.88 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|