C26H20N4O4S3 — CID 4709914
4-[[4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 4709914) has the molecular formula C26H20N4O4S3 and a molecular weight of 548.67 g/mol. Its IUPAC name is 4-[[4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 4709914 |
| Molecular Formula | C26H20N4O4S3 |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | 4-[[4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(-c3ccccc3)o2)S/C1=N\c1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C26H20N4O4S3/c1-2-15-30-24(31)23(17-20-10-13-22(34-20)18-6-4-3-5-7-18)36-26(30)28-19-8-11-21(12-9-19)37(32,33)29-25-27-14-16-35-25/h2-14,16-17H,1,15H2,(H,27,29)/b23-17?,28-26- |
| InChIKey | VPAXYTVIICAEII-SYXCWMFOSA-N |
| XLogP | 5.99 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|