C26H18Cl2N4O4S3 — CID 18806991
4-[[(5Z)-5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 18806991) has the molecular formula C26H18Cl2N4O4S3 and a molecular weight of 617.56 g/mol. Its IUPAC name is 4-[[(5Z)-5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[(5Z)-5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 18806991 |
| Molecular Formula | C26H18Cl2N4O4S3 |
| Molecular Weight | 617.56 g/mol |
| Exact Mass | 615.99 |
| IUPAC Name | 4-[[(5Z)-5-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(-c3cc(Cl)cc(Cl)c3)o2)S/C1=N\c1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C26H18Cl2N4O4S3/c1-2-10-32-24(33)23(15-20-5-8-22(36-20)16-12-17(27)14-18(28)13-16)38-26(32)30-19-3-6-21(7-4-19)39(34,35)31-25-29-9-11-37-25/h2-9,11-15H,1,10H2,(H,29,31)/b23-15-,30-26- |
| InChIKey | FHJPZRYFXUZHPT-GFRXOEILSA-N |
| XLogP | 7.30 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.56 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|