C22H15BrClN3O2S — CID 18843397
(5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 18843397) has the molecular formula C22H15BrClN3O2S and a molecular weight of 500.81 g/mol. Its IUPAC name is (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843397 |
| Molecular Formula | C22H15BrClN3O2S |
| Molecular Weight | 500.81 g/mol |
| Exact Mass | 498.98 |
| IUPAC Name | (5E)-5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-[(2-chloro-3-pyridinyl)imino]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C\c2ccc(-c3ccc(Br)cc3)o2)S/C1=N\c1cccnc1Cl |
| InChI | InChI=1S/C22H15BrClN3O2S/c1-2-12-27-21(28)19(30-22(27)26-17-4-3-11-25-20(17)24)13-16-9-10-18(29-16)14-5-7-15(23)8-6-14/h2-11,13H,1,12H2/b19-13+,26-22- |
| InChIKey | WFBVHENYLCGHGV-HHGPXSHDSA-N |
| XLogP | 6.55 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.81 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|