C22H15ClN4O4S — CID 18843913
(5E)-2-[(3-chloro-4-pyridinyl)imino]-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 18843913) has the molecular formula C22H15ClN4O4S and a molecular weight of 466.91 g/mol. Its IUPAC name is (5E)-2-[(3-chloro-4-pyridinyl)imino]-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-[(3-chloro-4-pyridinyl)imino]-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18843913 |
| Molecular Formula | C22H15ClN4O4S |
| Molecular Weight | 466.91 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | (5E)-2-[(3-chloro-4-pyridinyl)imino]-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C\c2ccc(-c3ccccc3[N+](=O)[O-])o2)S/C1=N\c1ccncc1Cl |
| InChI | InChI=1S/C22H15ClN4O4S/c1-2-11-26-21(28)20(32-22(26)25-17-9-10-24-13-16(17)23)12-14-7-8-19(31-14)15-5-3-4-6-18(15)27(29)30/h2-10,12-13H,1,11H2/b20-12+,25-22- |
| InChIKey | GRNWOBVPCVYFIH-DSEZMCGYSA-N |
| XLogP | 5.69 |
| TPSA | 101.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.91 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|