C18H14N4O3S — CID 18842409
(5Z)-5-[(2-nitrophenyl)methylidene]-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one (PubChem CID 18842409) has the molecular formula C18H14N4O3S and a molecular weight of 366.40 g/mol. Its IUPAC name is (5Z)-5-[(2-nitrophenyl)methylidene]-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2-nitrophenyl)methylidene]-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18842409 |
| Molecular Formula | C18H14N4O3S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (5Z)-5-[(2-nitrophenyl)methylidene]-3-prop-2-enyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C/c2ccccc2[N+](=O)[O-])S/C1=N/c1cccnc1 |
| InChI | InChI=1S/C18H14N4O3S/c1-2-10-21-17(23)16(11-13-6-3-4-8-15(13)22(24)25)26-18(21)20-14-7-5-9-19-12-14/h2-9,11-12H,1,10H2/b16-11-,20-18+ |
| InChIKey | VQBXUDPYIPMJTL-FMIVOPDJSA-N |
| XLogP | 3.78 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|