C23H19N5O3S — CID 4709728
2-(4-methylphenyl)imino-5-[[5-(3-nitrophenyl)-1H-pyrazol-4-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 4709728) has the molecular formula C23H19N5O3S and a molecular weight of 445.50 g/mol. Its IUPAC name is 2-(4-methylphenyl)imino-5-[[5-(3-nitrophenyl)-1H-pyrazol-4-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-methylphenyl)imino-5-[[5-(3-nitrophenyl)-1H-pyrazol-4-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4709728 |
| Molecular Formula | C23H19N5O3S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-(4-methylphenyl)imino-5-[[5-(3-nitrophenyl)-1H-pyrazol-4-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=Cc2cn[nH]c2-c2cccc([N+](=O)[O-])c2)S/C1=N\c1ccc(C)cc1 |
| InChI | InChI=1S/C23H19N5O3S/c1-3-11-27-22(29)20(32-23(27)25-18-9-7-15(2)8-10-18)13-17-14-24-26-21(17)16-5-4-6-19(12-16)28(30)31/h3-10,12-14H,1,11H2,2H3,(H,24,26)/b20-13?,25-23- |
| InChIKey | UEDRKFZIBSZLAF-KRXJNCOJSA-N |
| XLogP | 5.08 |
| TPSA | 104.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|