C25H19BrFN3O4S — CID 126237089
(5E)-5-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126237089) has the molecular formula C25H19BrFN3O4S and a molecular weight of 556.41 g/mol. Its IUPAC name is (5E)-5-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126237089 |
| Molecular Formula | C25H19BrFN3O4S |
| Molecular Weight | 556.41 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | (5E)-5-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(Br)ccc2OCc2cccc([N+](=O)[O-])c2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C25H19BrFN3O4S/c1-2-29-24(31)23(35-25(29)28-20-9-7-19(27)8-10-20)14-17-13-18(26)6-11-22(17)34-15-16-4-3-5-21(12-16)30(32)33/h3-14H,2,15H2,1H3/b23-14+,28-25- |
| InChIKey | HDQAKIKVLDJFIA-JWFYUTLFSA-N |
| XLogP | 6.70 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.41 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|