C19H16BrN3O4S — CID 1285391
5-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 1285391) has the molecular formula C19H16BrN3O4S and a molecular weight of 462.33 g/mol. Its IUPAC name is 5-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 1285391 |
| Molecular Formula | C19H16BrN3O4S |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | 5-[[5-bromo-2-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)C(=Cc2cc(Br)ccc2OCc2cccc([N+](=O)[O-])c2)NC1=S |
| InChI | InChI=1S/C19H16BrN3O4S/c1-2-22-18(24)16(21-19(22)28)10-13-9-14(20)6-7-17(13)27-11-12-4-3-5-15(8-12)23(25)26/h3-10H,2,11H2,1H3,(H,21,28) |
| InChIKey | WUTGGVIFYDKIAO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_I(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|