C18H14BrFN2O2S — CID 1346393
5-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 1346393) has the molecular formula C18H14BrFN2O2S and a molecular weight of 421.29 g/mol. Its IUPAC name is 5-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 1346393 |
| Molecular Formula | C18H14BrFN2O2S |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 5-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=O)C(=Cc2cc(Br)ccc2OCc2cccc(F)c2)NC1=S |
| InChI | InChI=1S/C18H14BrFN2O2S/c1-22-17(23)15(21-18(22)25)9-12-8-13(19)5-6-16(12)24-10-11-3-2-4-14(20)7-11/h2-9H,10H2,1H3,(H,21,25) |
| InChIKey | CXELUGRZBVQDQA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_I(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|