C23H14BrFO3 — CID 1329735
2-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]indene-1,3-dione (PubChem CID 1329735) has the molecular formula C23H14BrFO3 and a molecular weight of 437.26 g/mol. Its IUPAC name is 2-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 1329735 |
| Molecular Formula | C23H14BrFO3 |
| Molecular Weight | 437.26 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | 2-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2cc(Br)ccc2OCc2cccc(F)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C23H14BrFO3/c24-16-8-9-21(28-13-14-4-3-5-17(25)10-14)15(11-16)12-20-22(26)18-6-1-2-7-19(18)23(20)27/h1-12H,13H2 |
| InChIKey | XUVJPNHBJGODLS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.26 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|