C23H22BrFN2O2S — CID 6522087
(5Z)-5-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 6522087) has the molecular formula C23H22BrFN2O2S and a molecular weight of 489.41 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 6522087 |
| Molecular Formula | C23H22BrFN2O2S |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | (5Z)-5-[[5-bromo-2-[(3-fluorophenyl)methoxy]phenyl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C/c2cc(Br)ccc2OCc2cccc(F)c2)NC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C23H22BrFN2O2S/c24-17-9-10-21(29-14-15-5-4-6-18(25)11-15)16(12-17)13-20-22(28)27(23(30)26-20)19-7-2-1-3-8-19/h4-6,9-13,19H,1-3,7-8,14H2,(H,26,30)/b20-13- |
| InChIKey | WBEIRZFRNLGYBP-MOSHPQCFSA-N |
| XLogP | 5.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|