C21H21BrN2O3S — CID 19547756
(5E)-5-[[5-[(3-bromophenoxy)methyl]furan-2-yl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 19547756) has the molecular formula C21H21BrN2O3S and a molecular weight of 461.38 g/mol. Its IUPAC name is (5E)-5-[[5-[(3-bromophenoxy)methyl]furan-2-yl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-[(3-bromophenoxy)methyl]furan-2-yl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19547756 |
| Molecular Formula | C21H21BrN2O3S |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | (5E)-5-[[5-[(3-bromophenoxy)methyl]furan-2-yl]methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(COc3cccc(Br)c3)o2)NC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C21H21BrN2O3S/c22-14-5-4-8-16(11-14)26-13-18-10-9-17(27-18)12-19-20(25)24(21(28)23-19)15-6-2-1-3-7-15/h4-5,8-12,15H,1-3,6-7,13H2,(H,23,28)/b19-12+ |
| InChIKey | GWJPBDOSMJGKGD-XDHOZWIPSA-N |
| XLogP | 5.01 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|