C23H21BrCl2N2O3 — CID 126091369
(5Z)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-cyclohexylimidazolidine-2,4-dione (PubChem CID 126091369) has the molecular formula C23H21BrCl2N2O3 and a molecular weight of 524.24 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-cyclohexylimidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-cyclohexylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126091369 |
| Molecular Formula | C23H21BrCl2N2O3 |
| Molecular Weight | 524.24 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | (5Z)-5-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-cyclohexylimidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C\c2cc(Br)ccc2OCc2ccc(Cl)cc2Cl)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C23H21BrCl2N2O3/c24-16-7-9-21(31-13-14-6-8-17(25)12-19(14)26)15(10-16)11-20-22(29)28(23(30)27-20)18-4-2-1-3-5-18/h6-12,18H,1-5,13H2,(H,27,30)/b20-11- |
| InChIKey | YCLYHJHHDPGGTH-JAIQZWGSSA-N |
| XLogP | 6.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.24 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|