C25H26Cl2N2O3S — CID 126086497
(5Z)-3-cyclohexyl-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126086497) has the molecular formula C25H26Cl2N2O3S and a molecular weight of 505.47 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126086497 |
| Molecular Formula | C25H26Cl2N2O3S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc(/C=C2/C(=O)N(C3CCCCC3)C(=S)N2C)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H26Cl2N2O3S/c1-28-21(24(30)29(25(28)33)19-6-4-3-5-7-19)12-16-8-11-22(23(13-16)31-2)32-15-17-9-10-18(26)14-20(17)27/h8-14,19H,3-7,15H2,1-2H3/b21-12- |
| InChIKey | LMPQJAPZJQJGRW-MTJSOVHGSA-N |
| XLogP | 6.31 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|