C16H17BrN2OS — CID 19547843
(5E)-5-[(2-bromophenyl)methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 19547843) has the molecular formula C16H17BrN2OS and a molecular weight of 365.30 g/mol. Its IUPAC name is (5E)-5-[(2-bromophenyl)methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(2-bromophenyl)methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19547843 |
| Molecular Formula | C16H17BrN2OS |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (5E)-5-[(2-bromophenyl)methylidene]-3-cyclohexyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccccc2Br)NC(=S)N1C1CCCCC1 |
| InChI | InChI=1S/C16H17BrN2OS/c17-13-9-5-4-6-11(13)10-14-15(20)19(16(21)18-14)12-7-2-1-3-8-12/h4-6,9-10,12H,1-3,7-8H2,(H,18,21)/b14-10+ |
| InChIKey | IWWGZIABQZRBPD-GXDHUFHOSA-N |
| XLogP | 3.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|