C14H12Br2N2O2S — CID 4523981
3-cyclopropyl-5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 4523981) has the molecular formula C14H12Br2N2O2S and a molecular weight of 432.14 g/mol. Its IUPAC name is 3-cyclopropyl-5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-cyclopropyl-5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 4523981 |
| Molecular Formula | C14H12Br2N2O2S |
| Molecular Weight | 432.14 g/mol |
| Exact Mass | 429.90 |
| IUPAC Name | 3-cyclopropyl-5-[(3,5-dibromo-2-methoxyphenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1c(Br)cc(Br)cc1C=C1NC(=S)N(C2CC2)C1=O |
| InChI | InChI=1S/C14H12Br2N2O2S/c1-20-12-7(4-8(15)6-10(12)16)5-11-13(19)18(9-2-3-9)14(21)17-11/h4-6,9H,2-3H2,1H3,(H,17,21) |
| InChIKey | OOWHYRIHGVVUPQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.14 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|