C24H16N4O4S2 — CID 4710060
2-(1,3-benzothiazol-2-ylimino)-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 4710060) has the molecular formula C24H16N4O4S2 and a molecular weight of 488.55 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylimino)-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(1,3-benzothiazol-2-ylimino)-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4710060 |
| Molecular Formula | C24H16N4O4S2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylimino)-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(-c3cccc([N+](=O)[O-])c3)o2)SC1=Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C24H16N4O4S2/c1-2-12-27-22(29)21(34-24(27)26-23-25-18-8-3-4-9-20(18)33-23)14-17-10-11-19(32-17)15-6-5-7-16(13-15)28(30)31/h2-11,13-14H,1,12H2 |
| InChIKey | SDHIJPOHRITFSW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 101.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|