C19H14N4O4S2 — CID 18844718
(2E,5E)-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 18844718) has the molecular formula C19H14N4O4S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is (2E,5E)-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844718 |
| Molecular Formula | C19H14N4O4S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | (2E,5E)-3-methyl-2-[(4-methyl-1,3-thiazol-2-yl)imino]-5-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1csc(/N=C2/S/C(=C/c3ccc(-c4cccc([N+](=O)[O-])c4)o3)C(=O)N2C)n1 |
| InChI | InChI=1S/C19H14N4O4S2/c1-11-10-28-18(20-11)21-19-22(2)17(24)16(29-19)9-14-6-7-15(27-14)12-4-3-5-13(8-12)23(25)26/h3-10H,1-2H3/b16-9+,21-19+ |
| InChIKey | LDBXQRKSYLYAQQ-IQLOBFSESA-N |
| XLogP | 4.85 |
| TPSA | 101.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|