C19H14N6O3S2 — CID 4709727
5-[[5-(3-nitrophenyl)-1H-pyrazol-4-yl]methylidene]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 4709727) has the molecular formula C19H14N6O3S2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 5-[[5-(3-nitrophenyl)-1H-pyrazol-4-yl]methylidene]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-(3-nitrophenyl)-1H-pyrazol-4-yl]methylidene]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4709727 |
| Molecular Formula | C19H14N6O3S2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 5-[[5-(3-nitrophenyl)-1H-pyrazol-4-yl]methylidene]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=Cc2cn[nH]c2-c2cccc([N+](=O)[O-])c2)SC1=Nc1nccs1 |
| InChI | InChI=1S/C19H14N6O3S2/c1-2-7-24-17(26)15(30-19(24)22-18-20-6-8-29-18)10-13-11-21-23-16(13)12-4-3-5-14(9-12)25(27)28/h2-6,8-11H,1,7H2,(H,21,23) |
| InChIKey | UNAGGIWCHMJCCK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|