C18H14N3O4S2- — CID 4134837
2-[4-[[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 4134837) has the molecular formula C18H14N3O4S2- and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-[4-[[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[4-[[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 4134837 |
| Molecular Formula | C18H14N3O4S2- |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 2-[4-[[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | C=CCN1C(=O)C(=Cc2ccc(OCC(=O)[O-])cc2)SC1=Nc1nccs1 |
| InChI | InChI=1S/C18H15N3O4S2/c1-2-8-21-16(24)14(27-18(21)20-17-19-7-9-26-17)10-12-3-5-13(6-4-12)25-11-15(22)23/h2-7,9-10H,1,8,11H2,(H,22,23)/p-1 |
| InChIKey | NAGQYDSHPWHPLC-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 94.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|