C18H13N5OS2 — CID 91901798
(2E,5Z)-3-prop-2-enyl-5-(quinoxalin-5-ylmethylidene)-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 91901798) has the molecular formula C18H13N5OS2 and a molecular weight of 379.47 g/mol. Its IUPAC name is (2E,5Z)-3-prop-2-enyl-5-(quinoxalin-5-ylmethylidene)-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-3-prop-2-enyl-5-(quinoxalin-5-ylmethylidene)-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 91901798 |
| Molecular Formula | C18H13N5OS2 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | (2E,5Z)-3-prop-2-enyl-5-(quinoxalin-5-ylmethylidene)-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C/c2cccc3nccnc23)S/C1=N/c1nccs1 |
| InChI | InChI=1S/C18H13N5OS2/c1-2-9-23-16(24)14(26-18(23)22-17-21-8-10-25-17)11-12-4-3-5-13-15(12)20-7-6-19-13/h2-8,10-11H,1,9H2/b14-11-,22-18+ |
| InChIKey | FSERWTQNRKYEPM-BAPXRPMLSA-N |
| XLogP | 3.88 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|